C8H17N2O+ — CID 54094876
1-(1,4-dimethylpiperazin-1-ium-1-yl)ethanone (PubChem CID 54094876) has the molecular formula C8H17N2O+ and a molecular weight of 157.24 g/mol. Its IUPAC name is 1-(1,4-dimethylpiperazin-1-ium-1-yl)ethanone.
| Compound Name | 1-(1,4-dimethylpiperazin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 54094876 |
| Molecular Formula | C8H17N2O+ |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | 1-(1,4-dimethylpiperazin-1-ium-1-yl)ethanone |
| SMILES | CC(=O)[N+]1(C)CCN(C)CC1 |
| InChI | InChI=1S/C8H17N2O/c1-8(11)10(3)6-4-9(2)5-7-10/h4-7H2,1-3H3/q+1 |
| InChIKey | MWKOESOWBJRBMC-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|