C14H25N4O+ — CID 126508416
acetamide;4-(1,4-dimethylpiperazin-1-ium-1-yl)aniline (PubChem CID 126508416) has the molecular formula C14H25N4O+ and a molecular weight of 265.38 g/mol. Its IUPAC name is acetamide;4-(1,4-dimethylpiperazin-1-ium-1-yl)aniline.
| Compound Name | acetamide;4-(1,4-dimethylpiperazin-1-ium-1-yl)aniline |
|---|---|
| PubChem CID | 126508416 |
| Molecular Formula | C14H25N4O+ |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | acetamide;4-(1,4-dimethylpiperazin-1-ium-1-yl)aniline |
| SMILES | CC(N)=O.CN1CC[N+](C)(c2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C12H20N3.C2H5NO/c1-14-7-9-15(2,10-8-14)12-5-3-11(13)4-6-12;1-2(3)4/h3-6H,7-10,13H2,1-2H3;1H3,(H2,3,4)/q+1; |
| InChIKey | QIJOEPDYAPSKIO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|