C10H23N2+ — CID 58529148
1-tert-butyl-1,4-dimethylpiperazin-1-ium (PubChem CID 58529148) has the molecular formula C10H23N2+ and a molecular weight of 171.31 g/mol. Its IUPAC name is 1-tert-butyl-1,4-dimethylpiperazin-1-ium.
| Compound Name | 1-tert-butyl-1,4-dimethylpiperazin-1-ium |
|---|---|
| PubChem CID | 58529148 |
| Molecular Formula | C10H23N2+ |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.19 |
| IUPAC Name | 1-tert-butyl-1,4-dimethylpiperazin-1-ium |
| SMILES | CN1CC[N+](C)(C(C)(C)C)CC1 |
| InChI | InChI=1S/C10H23N2/c1-10(2,3)12(5)8-6-11(4)7-9-12/h6-9H2,1-5H3/q+1 |
| InChIKey | RTJMKEPXBMIKTO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|