C16H44N2 — CID 91292414
1,4-dimethylpiperazine;ethane (PubChem CID 91292414) has the molecular formula C16H44N2 and a molecular weight of 264.54 g/mol. Its IUPAC name is 1,4-dimethylpiperazine;ethane.
| Compound Name | 1,4-dimethylpiperazine;ethane |
|---|---|
| PubChem CID | 91292414 |
| Molecular Formula | C16H44N2 |
| Molecular Weight | 264.54 g/mol |
| Exact Mass | 264.35 |
| IUPAC Name | 1,4-dimethylpiperazine;ethane |
| SMILES | CC.CC.CC.CC.CC.CN1CCN(C)CC1 |
| InChI | InChI=1S/C6H14N2.5C2H6/c1-7-3-5-8(2)6-4-7;5*1-2/h3-6H2,1-2H3;5*1-2H3 |
| InChIKey | KJBDXJMAUQLWLV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |