About 1,4-dimethylpiperazine;iron(5+);pentacyanide
1,4-dimethylpiperazine;iron(5+);pentacyanide (PubChem CID 88790382) has the molecular formula C11H14FeN7
and a molecular weight of 300.13 g/mol. Its IUPAC name is 1,4-dimethylpiperazine;iron(5+);pentacyanide.
Molecular Properties
| Compound Name | 1,4-dimethylpiperazine;iron(5+);pentacyanide |
| PubChem CID | 88790382 |
| Molecular Formula | C11H14FeN7 |
| Molecular Weight | 300.13 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1,4-dimethylpiperazine;iron(5+);pentacyanide |
| SMILES | CN1CCN(C)CC1.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[Fe+5] |
| InChI | InChI=1S/C6H14N2.5CN.Fe/c1-7-3-5-8(2)6-4-7;5*1-2;/h3-6H2,1-2H3;;;;;;/q;5*-1;+5 |
| InChIKey | QXTHRAFTNFHBBM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 125.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.13 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethylpiperazine;iron(5+);pentacyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylpiperazine;iron(5+);pentacyanide?
The IUPAC name of 1,4-dimethylpiperazine;iron(5+);pentacyanide (CID 88790382) is 1,4-dimethylpiperazine;iron(5+);pentacyanide.
What is the SMILES notation for 1,4-dimethylpiperazine;iron(5+);pentacyanide?
The canonical SMILES for 1,4-dimethylpiperazine;iron(5+);pentacyanide is CN1CCN(C)CC1.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[Fe+5].
What is the InChIKey of 1,4-dimethylpiperazine;iron(5+);pentacyanide?
The InChIKey is QXTHRAFTNFHBBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.5CN.Fe/c1-7-3-5-8(2)6-4-7;5*1-2;/h3-6H2,1-2H3;;;;;;/q;5*-1;+5.
What are the key properties of 1,4-dimethylpiperazine;iron(5+);pentacyanide?
1,4-dimethylpiperazine;iron(5+);pentacyanide has a molecular weight of 300.13 g/mol, XLogP of 0.34, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylpiperazine;iron(5+);pentacyanide is sourced from PubChem (CID 88790382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).