About 1-ethyl-1,4-dimethylpiperazin-1-ium
1-ethyl-1,4-dimethylpiperazin-1-ium (PubChem CID 19774336) has the molecular formula C8H19N2+
and a molecular weight of 143.25 g/mol. Its IUPAC name is 1-ethyl-1,4-dimethylpiperazin-1-ium.
Molecular Properties
| Compound Name | 1-ethyl-1,4-dimethylpiperazin-1-ium |
| PubChem CID | 19774336 |
| Molecular Formula | C8H19N2+ |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.15 |
| IUPAC Name | 1-ethyl-1,4-dimethylpiperazin-1-ium |
| SMILES | CC[N+]1(C)CCN(C)CC1 |
| InChI | InChI=1S/C8H19N2/c1-4-10(3)7-5-9(2)6-8-10/h4-8H2,1-3H3/q+1 |
| InChIKey | RKLZPMDBTNCDQN-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1,4-dimethylpiperazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1,4-dimethylpiperazin-1-ium?
The IUPAC name of 1-ethyl-1,4-dimethylpiperazin-1-ium (CID 19774336) is 1-ethyl-1,4-dimethylpiperazin-1-ium.
What is the SMILES notation for 1-ethyl-1,4-dimethylpiperazin-1-ium?
The canonical SMILES for 1-ethyl-1,4-dimethylpiperazin-1-ium is CC[N+]1(C)CCN(C)CC1.
What is the InChIKey of 1-ethyl-1,4-dimethylpiperazin-1-ium?
The InChIKey is RKLZPMDBTNCDQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N2/c1-4-10(3)7-5-9(2)6-8-10/h4-8H2,1-3H3/q+1.
What are the key properties of 1-ethyl-1,4-dimethylpiperazin-1-ium?
1-ethyl-1,4-dimethylpiperazin-1-ium has a molecular weight of 143.25 g/mol, XLogP of 0.40, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1,4-dimethylpiperazin-1-ium is sourced from PubChem (CID 19774336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).