About 1,4-dimethylpiperazine
1,4-dimethylpiperazine (PubChem CID 7818) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is 1,4-dimethylpiperazine.
Molecular Properties
| Compound Name | 1,4-dimethylpiperazine |
| PubChem CID | 7818 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | 1,4-dimethylpiperazine |
| SMILES | CN1CCN(C)CC1 |
| InChI | InChI=1S/C6H14N2/c1-7-3-5-8(2)6-4-7/h3-6H2,1-2H3 |
| InChIKey | RXYPXQSKLGGKOL-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylpiperazine?
The IUPAC name of 1,4-dimethylpiperazine (CID 7818) is 1,4-dimethylpiperazine.
What is the SMILES notation for 1,4-dimethylpiperazine?
The canonical SMILES for 1,4-dimethylpiperazine is CN1CCN(C)CC1.
What is the InChIKey of 1,4-dimethylpiperazine?
The InChIKey is RXYPXQSKLGGKOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2/c1-7-3-5-8(2)6-4-7/h3-6H2,1-2H3.
What are the key properties of 1,4-dimethylpiperazine?
1,4-dimethylpiperazine has a molecular weight of 114.19 g/mol, XLogP of -0.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylpiperazine is sourced from PubChem (CID 7818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).