C17H37N2+ — CID 168851440
1-tert-butyl-4-(5,5-dimethylhexyl)-1-methylpiperazin-1-ium (PubChem CID 168851440) has the molecular formula C17H37N2+ and a molecular weight of 269.50 g/mol. Its IUPAC name is 1-tert-butyl-4-(5,5-dimethylhexyl)-1-methylpiperazin-1-ium.
| Compound Name | 1-tert-butyl-4-(5,5-dimethylhexyl)-1-methylpiperazin-1-ium |
|---|---|
| PubChem CID | 168851440 |
| Molecular Formula | C17H37N2+ |
| Molecular Weight | 269.50 g/mol |
| Exact Mass | 269.30 |
| IUPAC Name | 1-tert-butyl-4-(5,5-dimethylhexyl)-1-methylpiperazin-1-ium |
| SMILES | CC(C)(C)CCCCN1CC[N+](C)(C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H37N2/c1-16(2,3)10-8-9-11-18-12-14-19(7,15-13-18)17(4,5)6/h8-15H2,1-7H3/q+1 |
| InChIKey | ZEJOMPJQTYXBKQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|