C20H42N2O — CID 134488975
1-(4,4-dimethylpentyl)-4-[5-[(2-methylpropan-2-yl)oxy]pentyl]piperazine (PubChem CID 134488975) has the molecular formula C20H42N2O and a molecular weight of 326.57 g/mol. Its IUPAC name is 1-(4,4-dimethylpentyl)-4-[5-[(2-methylpropan-2-yl)oxy]pentyl]piperazine.
| Compound Name | 1-(4,4-dimethylpentyl)-4-[5-[(2-methylpropan-2-yl)oxy]pentyl]piperazine |
|---|---|
| PubChem CID | 134488975 |
| Molecular Formula | C20H42N2O |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.33 |
| IUPAC Name | 1-(4,4-dimethylpentyl)-4-[5-[(2-methylpropan-2-yl)oxy]pentyl]piperazine |
| SMILES | CC(C)(C)CCCN1CCN(CCCCCOC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H42N2O/c1-19(2,3)11-10-13-22-16-14-21(15-17-22)12-8-7-9-18-23-20(4,5)6/h7-18H2,1-6H3 |
| InChIKey | YJUFIJVYFRXBFY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|