C19H39F2N3O2 — CID 155215147
N-ethyl-2,2-difluoro-3-[4-[4-[2-[(2-methylpropan-2-yl)oxy]ethyl]piperazin-1-yl]butoxy]propan-1-amine (PubChem CID 155215147) has the molecular formula C19H39F2N3O2 and a molecular weight of 379.54 g/mol. Its IUPAC name is N-ethyl-2,2-difluoro-3-[4-[4-[2-[(2-methylpropan-2-yl)oxy]ethyl]piperazin-1-yl]butoxy]propan-1-amine.
| Compound Name | N-ethyl-2,2-difluoro-3-[4-[4-[2-[(2-methylpropan-2-yl)oxy]ethyl]piperazin-1-yl]butoxy]propan-1-amine |
|---|---|
| PubChem CID | 155215147 |
| Molecular Formula | C19H39F2N3O2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.30 |
| IUPAC Name | N-ethyl-2,2-difluoro-3-[4-[4-[2-[(2-methylpropan-2-yl)oxy]ethyl]piperazin-1-yl]butoxy]propan-1-amine |
| SMILES | CCNCC(F)(F)COCCCCN1CCN(CCOC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H39F2N3O2/c1-5-22-16-19(20,21)17-25-14-7-6-8-23-9-11-24(12-10-23)13-15-26-18(2,3)4/h22H,5-17H2,1-4H3 |
| InChIKey | DIXQIFQVSMELCG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|