C16H35F2N3O2 — CID 142386100
2-[4-[4-[2,2-difluoro-3-(methylamino)propoxy]butyl]piperazin-1-yl]ethanol;ethane (PubChem CID 142386100) has the molecular formula C16H35F2N3O2 and a molecular weight of 339.47 g/mol. Its IUPAC name is 2-[4-[4-[2,2-difluoro-3-(methylamino)propoxy]butyl]piperazin-1-yl]ethanol;ethane.
| Compound Name | 2-[4-[4-[2,2-difluoro-3-(methylamino)propoxy]butyl]piperazin-1-yl]ethanol;ethane |
|---|---|
| PubChem CID | 142386100 |
| Molecular Formula | C16H35F2N3O2 |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.27 |
| IUPAC Name | 2-[4-[4-[2,2-difluoro-3-(methylamino)propoxy]butyl]piperazin-1-yl]ethanol;ethane |
| SMILES | CC.CNCC(F)(F)COCCCCN1CCN(CCO)CC1 |
| InChI | InChI=1S/C14H29F2N3O2.C2H6/c1-17-12-14(15,16)13-21-11-3-2-4-18-5-7-19(8-6-18)9-10-20;1-2/h17,20H,2-13H2,1H3;1-2H3 |
| InChIKey | UPCCTBUBSOQZCF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|