C13H29N3O3 — CID 142367989
2-[4-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]piperazin-1-yl]ethanol (PubChem CID 142367989) has the molecular formula C13H29N3O3 and a molecular weight of 275.39 g/mol. Its IUPAC name is 2-[4-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 142367989 |
| Molecular Formula | C13H29N3O3 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 2-[4-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]piperazin-1-yl]ethanol |
| SMILES | CNCCOCCOCCN1CCN(CCO)CC1 |
| InChI | InChI=1S/C13H29N3O3/c1-14-2-10-18-12-13-19-11-8-16-5-3-15(4-6-16)7-9-17/h14,17H,2-13H2,1H3 |
| InChIKey | KHSYKTHSIFIWRE-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|