C13H26F2N2O3 — CID 142385812
2,2-difluoro-3-[4-[4-(2-hydroxyethyl)piperazin-1-yl]butoxy]propan-1-ol (PubChem CID 142385812) has the molecular formula C13H26F2N2O3 and a molecular weight of 296.36 g/mol. Its IUPAC name is 2,2-difluoro-3-[4-[4-(2-hydroxyethyl)piperazin-1-yl]butoxy]propan-1-ol.
| Compound Name | 2,2-difluoro-3-[4-[4-(2-hydroxyethyl)piperazin-1-yl]butoxy]propan-1-ol |
|---|---|
| PubChem CID | 142385812 |
| Molecular Formula | C13H26F2N2O3 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 2,2-difluoro-3-[4-[4-(2-hydroxyethyl)piperazin-1-yl]butoxy]propan-1-ol |
| SMILES | OCCN1CCN(CCCCOCC(F)(F)CO)CC1 |
| InChI | InChI=1S/C13H26F2N2O3/c14-13(15,11-19)12-20-10-2-1-3-16-4-6-17(7-5-16)8-9-18/h18-19H,1-12H2 |
| InChIKey | MBEWNCJMKBFUGH-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|