C14H28F2N2O3 — CID 142367353
2-[4-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazin-1-yl]ethanol (PubChem CID 142367353) has the molecular formula C14H28F2N2O3 and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-[4-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 142367353 |
| Molecular Formula | C14H28F2N2O3 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 2-[4-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazin-1-yl]ethanol |
| SMILES | COCC(F)(F)COCCCCN1CCN(CCO)CC1 |
| InChI | InChI=1S/C14H28F2N2O3/c1-20-12-14(15,16)13-21-11-3-2-4-17-5-7-18(8-6-17)9-10-19/h19H,2-13H2,1H3 |
| InChIKey | OBJZDZWZMQVALO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|