C20H42N2O4 — CID 171446821
1-tert-butyl-4-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]ethoxy]ethyl]piperazine (PubChem CID 171446821) has the molecular formula C20H42N2O4 and a molecular weight of 374.57 g/mol. Its IUPAC name is 1-tert-butyl-4-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]ethoxy]ethyl]piperazine.
| Compound Name | 1-tert-butyl-4-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]ethoxy]ethyl]piperazine |
|---|---|
| PubChem CID | 171446821 |
| Molecular Formula | C20H42N2O4 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.31 |
| IUPAC Name | 1-tert-butyl-4-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]ethoxy]ethyl]piperazine |
| SMILES | CC(C)(C)OCCOCCOCCOCCN1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C20H42N2O4/c1-19(2,3)22-9-7-21(8-10-22)11-12-23-13-14-24-15-16-25-17-18-26-20(4,5)6/h7-18H2,1-6H3 |
| InChIKey | ZLNLJYALXRWQDC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|