C19H41N3O3 — CID 167191561
N-[2-[2-[2-[2-(4-tert-butylpiperazin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]propan-1-amine (PubChem CID 167191561) has the molecular formula C19H41N3O3 and a molecular weight of 359.56 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(4-tert-butylpiperazin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]propan-1-amine.
| Compound Name | N-[2-[2-[2-[2-(4-tert-butylpiperazin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 167191561 |
| Molecular Formula | C19H41N3O3 |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.31 |
| IUPAC Name | N-[2-[2-[2-[2-(4-tert-butylpiperazin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]propan-1-amine |
| SMILES | CCCNCCOCCOCCOCCN1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H41N3O3/c1-5-6-20-7-13-23-15-17-25-18-16-24-14-12-21-8-10-22(11-9-21)19(2,3)4/h20H,5-18H2,1-4H3 |
| InChIKey | FJIKNMOTBCEDFZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|