C19H40N2O2 — CID 139545698
1-tert-butyl-4-[2-[2-(4,4-dimethylpentoxy)ethoxy]ethyl]piperazine (PubChem CID 139545698) has the molecular formula C19H40N2O2 and a molecular weight of 328.54 g/mol. Its IUPAC name is 1-tert-butyl-4-[2-[2-(4,4-dimethylpentoxy)ethoxy]ethyl]piperazine.
| Compound Name | 1-tert-butyl-4-[2-[2-(4,4-dimethylpentoxy)ethoxy]ethyl]piperazine |
|---|---|
| PubChem CID | 139545698 |
| Molecular Formula | C19H40N2O2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.31 |
| IUPAC Name | 1-tert-butyl-4-[2-[2-(4,4-dimethylpentoxy)ethoxy]ethyl]piperazine |
| SMILES | CC(C)(C)CCCOCCOCCN1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H40N2O2/c1-18(2,3)8-7-14-22-16-17-23-15-13-20-9-11-21(12-10-20)19(4,5)6/h7-17H2,1-6H3 |
| InChIKey | JYFUNCXXIGDUMB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|