C22H45N3 — CID 155244121
1-tert-butyl-4-[[1-(5,5-dimethylhexyl)piperidin-4-yl]methyl]piperazine (PubChem CID 155244121) has the molecular formula C22H45N3 and a molecular weight of 351.62 g/mol. Its IUPAC name is 1-tert-butyl-4-[[1-(5,5-dimethylhexyl)piperidin-4-yl]methyl]piperazine.
| Compound Name | 1-tert-butyl-4-[[1-(5,5-dimethylhexyl)piperidin-4-yl]methyl]piperazine |
|---|---|
| PubChem CID | 155244121 |
| Molecular Formula | C22H45N3 |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 351.36 |
| IUPAC Name | 1-tert-butyl-4-[[1-(5,5-dimethylhexyl)piperidin-4-yl]methyl]piperazine |
| SMILES | CC(C)(C)CCCCN1CCC(CN2CCN(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C22H45N3/c1-21(2,3)11-7-8-12-23-13-9-20(10-14-23)19-24-15-17-25(18-16-24)22(4,5)6/h20H,7-19H2,1-6H3 |
| InChIKey | KGKBVBQNCHKPRI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|