About 1-(3,3-dimethylbutyl)-4-(4,4-dimethylpentyl)piperidine
1-(3,3-dimethylbutyl)-4-(4,4-dimethylpentyl)piperidine (PubChem CID 176826648) has the molecular formula C18H37N
and a molecular weight of 267.50 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-4-(4,4-dimethylpentyl)piperidine.
Molecular Properties
| Compound Name | 1-(3,3-dimethylbutyl)-4-(4,4-dimethylpentyl)piperidine |
| PubChem CID | 176826648 |
| Molecular Formula | C18H37N |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 267.29 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-4-(4,4-dimethylpentyl)piperidine |
| SMILES | CC(C)(C)CCCC1CCN(CCC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H37N/c1-17(2,3)11-7-8-16-9-13-19(14-10-16)15-12-18(4,5)6/h16H,7-15H2,1-6H3 |
| InChIKey | IMTXPIKNQUJCCH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3,3-dimethylbutyl)-4-(4,4-dimethylpentyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylbutyl)-4-(4,4-dimethylpentyl)piperidine?
The IUPAC name of 1-(3,3-dimethylbutyl)-4-(4,4-dimethylpentyl)piperidine (CID 176826648) is 1-(3,3-dimethylbutyl)-4-(4,4-dimethylpentyl)piperidine.
What is the SMILES notation for 1-(3,3-dimethylbutyl)-4-(4,4-dimethylpentyl)piperidine?
The canonical SMILES for 1-(3,3-dimethylbutyl)-4-(4,4-dimethylpentyl)piperidine is CC(C)(C)CCCC1CCN(CCC(C)(C)C)CC1.
What is the InChIKey of 1-(3,3-dimethylbutyl)-4-(4,4-dimethylpentyl)piperidine?
The InChIKey is IMTXPIKNQUJCCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37N/c1-17(2,3)11-7-8-16-9-13-19(14-10-16)15-12-18(4,5)6/h16H,7-15H2,1-6H3.
What are the key properties of 1-(3,3-dimethylbutyl)-4-(4,4-dimethylpentyl)piperidine?
1-(3,3-dimethylbutyl)-4-(4,4-dimethylpentyl)piperidine has a molecular weight of 267.50 g/mol, XLogP of 5.35, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylbutyl)-4-(4,4-dimethylpentyl)piperidine is sourced from PubChem (CID 176826648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).