About 1-[4-[1-(3,3-dimethylbutyl)azepan-4-yl]-3,3-dimethylbutyl]azocane
1-[4-[1-(3,3-dimethylbutyl)azepan-4-yl]-3,3-dimethylbutyl]azocane (PubChem CID 170446747) has the molecular formula C25H50N2
and a molecular weight of 378.69 g/mol. Its IUPAC name is 1-[4-[1-(3,3-dimethylbutyl)azepan-4-yl]-3,3-dimethylbutyl]azocane.
Molecular Properties
| Compound Name | 1-[4-[1-(3,3-dimethylbutyl)azepan-4-yl]-3,3-dimethylbutyl]azocane |
| PubChem CID | 170446747 |
| Molecular Formula | C25H50N2 |
| Molecular Weight | 378.69 g/mol |
| Exact Mass | 378.40 |
| IUPAC Name | 1-[4-[1-(3,3-dimethylbutyl)azepan-4-yl]-3,3-dimethylbutyl]azocane |
| SMILES | CC(C)(C)CCN1CCCC(CC(C)(C)CCN2CCCCCCC2)CC1 |
| InChI | InChI=1S/C25H50N2/c1-24(2,3)14-20-27-18-11-12-23(13-19-27)22-25(4,5)15-21-26-16-9-7-6-8-10-17-26/h23H,6-22H2,1-5H3 |
| InChIKey | VSJSKIIGQZQICG-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.69 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-[1-(3,3-dimethylbutyl)azepan-4-yl]-3,3-dimethylbutyl]azocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[1-(3,3-dimethylbutyl)azepan-4-yl]-3,3-dimethylbutyl]azocane?
The IUPAC name of 1-[4-[1-(3,3-dimethylbutyl)azepan-4-yl]-3,3-dimethylbutyl]azocane (CID 170446747) is 1-[4-[1-(3,3-dimethylbutyl)azepan-4-yl]-3,3-dimethylbutyl]azocane.
What is the SMILES notation for 1-[4-[1-(3,3-dimethylbutyl)azepan-4-yl]-3,3-dimethylbutyl]azocane?
The canonical SMILES for 1-[4-[1-(3,3-dimethylbutyl)azepan-4-yl]-3,3-dimethylbutyl]azocane is CC(C)(C)CCN1CCCC(CC(C)(C)CCN2CCCCCCC2)CC1.
What is the InChIKey of 1-[4-[1-(3,3-dimethylbutyl)azepan-4-yl]-3,3-dimethylbutyl]azocane?
The InChIKey is VSJSKIIGQZQICG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H50N2/c1-24(2,3)14-20-27-18-11-12-23(13-19-27)22-25(4,5)15-21-26-16-9-7-6-8-10-17-26/h23H,6-22H2,1-5H3.
What are the key properties of 1-[4-[1-(3,3-dimethylbutyl)azepan-4-yl]-3,3-dimethylbutyl]azocane?
1-[4-[1-(3,3-dimethylbutyl)azepan-4-yl]-3,3-dimethylbutyl]azocane has a molecular weight of 378.69 g/mol, XLogP of 6.60, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[1-(3,3-dimethylbutyl)azepan-4-yl]-3,3-dimethylbutyl]azocane is sourced from PubChem (CID 170446747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).