C16H31N3 — CID 106709889
6-(4-tert-butylpiperazin-1-yl)-2,2-dimethylhexanenitrile (PubChem CID 106709889) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is 6-(4-tert-butylpiperazin-1-yl)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(4-tert-butylpiperazin-1-yl)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106709889 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | 6-(4-tert-butylpiperazin-1-yl)-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCN1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H31N3/c1-15(2,3)19-12-10-18(11-13-19)9-7-6-8-16(4,5)14-17/h6-13H2,1-5H3 |
| InChIKey | CSPLGOVWJROCDH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|