C16H30N2O — CID 106710148
2,2-dimethyl-6-(2,2,6,6-tetramethylmorpholin-4-yl)hexanenitrile (PubChem CID 106710148) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 2,2-dimethyl-6-(2,2,6,6-tetramethylmorpholin-4-yl)hexanenitrile.
| Compound Name | 2,2-dimethyl-6-(2,2,6,6-tetramethylmorpholin-4-yl)hexanenitrile |
|---|---|
| PubChem CID | 106710148 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 2,2-dimethyl-6-(2,2,6,6-tetramethylmorpholin-4-yl)hexanenitrile |
| SMILES | CC(C)(C#N)CCCCN1CC(C)(C)OC(C)(C)C1 |
| InChI | InChI=1S/C16H30N2O/c1-14(2,11-17)9-7-8-10-18-12-15(3,4)19-16(5,6)13-18/h7-10,12-13H2,1-6H3 |
| InChIKey | KSXSRRVMLLKGEE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|