About 4-(5-bromopentyl)-2,2,6,6-tetramethylmorpholine
4-(5-bromopentyl)-2,2,6,6-tetramethylmorpholine (PubChem CID 102745281) has the molecular formula C13H26BrNO
and a molecular weight of 292.26 g/mol. Its IUPAC name is 4-(5-bromopentyl)-2,2,6,6-tetramethylmorpholine.
Molecular Properties
| Compound Name | 4-(5-bromopentyl)-2,2,6,6-tetramethylmorpholine |
| PubChem CID | 102745281 |
| Molecular Formula | C13H26BrNO |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 4-(5-bromopentyl)-2,2,6,6-tetramethylmorpholine |
| SMILES | CC1(C)CN(CCCCCBr)CC(C)(C)O1 |
| InChI | InChI=1S/C13H26BrNO/c1-12(2)10-15(9-7-5-6-8-14)11-13(3,4)16-12/h5-11H2,1-4H3 |
| InChIKey | MVSCWJIDAWRBJL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-bromopentyl)-2,2,6,6-tetramethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromopentyl)-2,2,6,6-tetramethylmorpholine?
The IUPAC name of 4-(5-bromopentyl)-2,2,6,6-tetramethylmorpholine (CID 102745281) is 4-(5-bromopentyl)-2,2,6,6-tetramethylmorpholine.
What is the SMILES notation for 4-(5-bromopentyl)-2,2,6,6-tetramethylmorpholine?
The canonical SMILES for 4-(5-bromopentyl)-2,2,6,6-tetramethylmorpholine is CC1(C)CN(CCCCCBr)CC(C)(C)O1.
What is the InChIKey of 4-(5-bromopentyl)-2,2,6,6-tetramethylmorpholine?
The InChIKey is MVSCWJIDAWRBJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26BrNO/c1-12(2)10-15(9-7-5-6-8-14)11-13(3,4)16-12/h5-11H2,1-4H3.
What are the key properties of 4-(5-bromopentyl)-2,2,6,6-tetramethylmorpholine?
4-(5-bromopentyl)-2,2,6,6-tetramethylmorpholine has a molecular weight of 292.26 g/mol, XLogP of 3.44, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromopentyl)-2,2,6,6-tetramethylmorpholine is sourced from PubChem (CID 102745281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).