C12H26N2O — CID 102743494
N-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propan-1-amine (PubChem CID 102743494) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is N-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propan-1-amine.
| Compound Name | N-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 102743494 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | N-methyl-3-(2,2,6,6-tetramethylmorpholin-4-yl)propan-1-amine |
| SMILES | CNCCCN1CC(C)(C)OC(C)(C)C1 |
| InChI | InChI=1S/C12H26N2O/c1-11(2)9-14(8-6-7-13-5)10-12(3,4)15-11/h13H,6-10H2,1-5H3 |
| InChIKey | OHDRCHUYZDVZKV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|