C12H22N2OS — CID 106709915
2,2-dimethyl-6-(1-oxo-1,4-thiazinan-4-yl)hexanenitrile (PubChem CID 106709915) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is 2,2-dimethyl-6-(1-oxo-1,4-thiazinan-4-yl)hexanenitrile.
| Compound Name | 2,2-dimethyl-6-(1-oxo-1,4-thiazinan-4-yl)hexanenitrile |
|---|---|
| PubChem CID | 106709915 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2,2-dimethyl-6-(1-oxo-1,4-thiazinan-4-yl)hexanenitrile |
| SMILES | CC(C)(C#N)CCCCN1CCS(=O)CC1 |
| InChI | InChI=1S/C12H22N2OS/c1-12(2,11-13)5-3-4-6-14-7-9-16(15)10-8-14/h3-10H2,1-2H3 |
| InChIKey | IFILOPVITBZEGR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|