C14H25N3O2 — CID 129490237
(2R)-2-[1-(4-cyano-4-methylpentyl)piperidin-4-yl]-2-hydroxyacetamide (PubChem CID 129490237) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is (2R)-2-[1-(4-cyano-4-methylpentyl)piperidin-4-yl]-2-hydroxyacetamide.
| Compound Name | (2R)-2-[1-(4-cyano-4-methylpentyl)piperidin-4-yl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 129490237 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | (2R)-2-[1-(4-cyano-4-methylpentyl)piperidin-4-yl]-2-hydroxyacetamide |
| SMILES | CC(C)(C#N)CCCN1CCC([C@@H](O)C(N)=O)CC1 |
| InChI | InChI=1S/C14H25N3O2/c1-14(2,10-15)6-3-7-17-8-4-11(5-9-17)12(18)13(16)19/h11-12,18H,3-9H2,1-2H3,(H2,16,19)/t12-/m1/s1 |
| InChIKey | WNGYUXNEDNCJOR-GFCCVEGCSA-N |
| XLogP | 0.87 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |