C17H32N2 — CID 65257423
5-(4-tert-butylazepan-1-yl)-2,2-dimethylpentanenitrile (PubChem CID 65257423) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is 5-(4-tert-butylazepan-1-yl)-2,2-dimethylpentanenitrile.
| Compound Name | 5-(4-tert-butylazepan-1-yl)-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65257423 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | 5-(4-tert-butylazepan-1-yl)-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCN1CCCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H32N2/c1-16(2,3)15-8-6-11-19(13-9-15)12-7-10-17(4,5)14-18/h15H,6-13H2,1-5H3 |
| InChIKey | BDKULMZPBCGMMN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |