C15H28N2 — CID 65257368
5-(4-ethylazepan-1-yl)-2,2-dimethylpentanenitrile (PubChem CID 65257368) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 5-(4-ethylazepan-1-yl)-2,2-dimethylpentanenitrile.
| Compound Name | 5-(4-ethylazepan-1-yl)-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65257368 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 5-(4-ethylazepan-1-yl)-2,2-dimethylpentanenitrile |
| SMILES | CCC1CCCN(CCCC(C)(C)C#N)CC1 |
| InChI | InChI=1S/C15H28N2/c1-4-14-7-5-10-17(12-8-14)11-6-9-15(2,3)13-16/h14H,4-12H2,1-3H3 |
| InChIKey | SZDNGMHGMKLOLT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |