5-(4-ethylazepan-1-yl)-2,2-dimethylpentanoic acid

C15H29NO2 — CID 65254850

IUPAC5-(4-ethylazepan-1-yl)-2,2-dimethylpentanoic acid
SMILESCCC1CCCN(CCCC(C)(C)C(=O)O)CC1
InChIInChI=1S/C15H29NO2/c1-4-13-7-5-10-16(12-8-13)11-6-9-15(2,3)14(17)18/h13H,4-12H2,1-3H3,(H,17,18)
InChIKeyAUXYSHUTPBSDRX-UHFFFAOYSA-N
MW255.40 g/mol
LogP3.39
Rot. Bonds6

About 5-(4-ethylazepan-1-yl)-2,2-dimethylpentanoic acid

5-(4-ethylazepan-1-yl)-2,2-dimethylpentanoic acid (PubChem CID 65254850) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is 5-(4-ethylazepan-1-yl)-2,2-dimethylpentanoic acid.

Molecular Properties

Compound Name5-(4-ethylazepan-1-yl)-2,2-dimethylpentanoic acid
PubChem CID65254850
Molecular FormulaC15H29NO2
Molecular Weight255.40 g/mol
Exact Mass255.22
IUPAC Name5-(4-ethylazepan-1-yl)-2,2-dimethylpentanoic acid
SMILESCCC1CCCN(CCCC(C)(C)C(=O)O)CC1
InChIInChI=1S/C15H29NO2/c1-4-13-7-5-10-16(12-8-13)11-6-9-15(2,3)14(17)18/h13H,4-12H2,1-3H3,(H,17,18)
InChIKeyAUXYSHUTPBSDRX-UHFFFAOYSA-N
XLogP3.39
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.40
LogP ≤ 53.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5-(4-ethylazepan-1-yl)-2,2-dimethylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(4-ethylazepan-1-yl)-2,2-dimethylpentanoic acid?
The IUPAC name of 5-(4-ethylazepan-1-yl)-2,2-dimethylpentanoic acid (CID 65254850) is 5-(4-ethylazepan-1-yl)-2,2-dimethylpentanoic acid.
What is the SMILES notation for 5-(4-ethylazepan-1-yl)-2,2-dimethylpentanoic acid?
The canonical SMILES for 5-(4-ethylazepan-1-yl)-2,2-dimethylpentanoic acid is CCC1CCCN(CCCC(C)(C)C(=O)O)CC1.
What is the InChIKey of 5-(4-ethylazepan-1-yl)-2,2-dimethylpentanoic acid?
The InChIKey is AUXYSHUTPBSDRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO2/c1-4-13-7-5-10-16(12-8-13)11-6-9-15(2,3)14(17)18/h13H,4-12H2,1-3H3,(H,17,18).
What are the key properties of 5-(4-ethylazepan-1-yl)-2,2-dimethylpentanoic acid?
5-(4-ethylazepan-1-yl)-2,2-dimethylpentanoic acid has a molecular weight of 255.40 g/mol, XLogP of 3.39, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-ethylazepan-1-yl)-2,2-dimethylpentanoic acid is sourced from PubChem (CID 65254850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).