2,2-dimethyl-5-morpholin-4-ylpentanoic acid

C11H21NO3 — CID 65254938

IUPAC2,2-dimethyl-5-morpholin-4-ylpentanoic acid
SMILESCC(C)(CCCN1CCOCC1)C(=O)O
InChIInChI=1S/C11H21NO3/c1-11(2,10(13)14)4-3-5-12-6-8-15-9-7-12/h3-9H2,1-2H3,(H,13,14)
InChIKeyMHOHNCRYIZMRKN-UHFFFAOYSA-N
MW215.29 g/mol
LogP1.21
Rot. Bonds5

About 2,2-dimethyl-5-morpholin-4-ylpentanoic acid

2,2-dimethyl-5-morpholin-4-ylpentanoic acid (PubChem CID 65254938) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 2,2-dimethyl-5-morpholin-4-ylpentanoic acid.

Molecular Properties

Compound Name2,2-dimethyl-5-morpholin-4-ylpentanoic acid
PubChem CID65254938
Molecular FormulaC11H21NO3
Molecular Weight215.29 g/mol
Exact Mass215.15
IUPAC Name2,2-dimethyl-5-morpholin-4-ylpentanoic acid
SMILESCC(C)(CCCN1CCOCC1)C(=O)O
InChIInChI=1S/C11H21NO3/c1-11(2,10(13)14)4-3-5-12-6-8-15-9-7-12/h3-9H2,1-2H3,(H,13,14)
InChIKeyMHOHNCRYIZMRKN-UHFFFAOYSA-N
XLogP1.21
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.29
LogP ≤ 51.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2,2-dimethyl-5-morpholin-4-ylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2,2-dimethyl-6-morpholin-4-ylhexanoic acid
CID 106713869
2,2-dimethyl-6-piperidin-1-ylhexanoic acid
CID 106713861
5-(2-ethylmorpholin-4-yl)-2,2-dimethylpentanoic acid
CID 65254891
2,2-dimethyl-5-(4-methylsulfonylpiperazin-1-yl)pentanoic acid
CID 65254899
5-(3,4-dimethylpyrrolidin-1-yl)-2,2-dimethylpentanoic acid
CID 79183884
2-methyl-2-(methylamino)-6-(1,4-oxazepan-4-yl)hexanoic acid
CID 62972427
4-(4-ethyl-4-methylhexyl)morpholine
CID 134251117
2-methyl-5-(1,4-oxazepan-4-yl)-2-(propylamino)pentanoic acid
CID 62973505
2-methyl-2-(3-morpholin-4-ylpropylamino)butanoic acid
CID 114994322
2,2-dimethyl-5-(3,3,4-trimethylpiperazin-1-yl)pentanoic acid
CID 65254593
2,2-dimethyl-4-(3-morpholin-4-ylpyrrolidin-1-yl)butanoic acid
CID 65248073
(2S)-2-(2,2-dimethylpropanoylamino)-2-ethyl-4-morpholin-4-ylbutanoic acid
CID 122454832

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethyl-5-morpholin-4-ylpentanoic acid?
The IUPAC name of 2,2-dimethyl-5-morpholin-4-ylpentanoic acid (CID 65254938) is 2,2-dimethyl-5-morpholin-4-ylpentanoic acid.
What is the SMILES notation for 2,2-dimethyl-5-morpholin-4-ylpentanoic acid?
The canonical SMILES for 2,2-dimethyl-5-morpholin-4-ylpentanoic acid is CC(C)(CCCN1CCOCC1)C(=O)O.
What is the InChIKey of 2,2-dimethyl-5-morpholin-4-ylpentanoic acid?
The InChIKey is MHOHNCRYIZMRKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-11(2,10(13)14)4-3-5-12-6-8-15-9-7-12/h3-9H2,1-2H3,(H,13,14).
What are the key properties of 2,2-dimethyl-5-morpholin-4-ylpentanoic acid?
2,2-dimethyl-5-morpholin-4-ylpentanoic acid has a molecular weight of 215.29 g/mol, XLogP of 1.21, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-5-morpholin-4-ylpentanoic acid is sourced from PubChem (CID 65254938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).