C14H26N2O3 — CID 65248073
2,2-dimethyl-4-(3-morpholin-4-ylpyrrolidin-1-yl)butanoic acid (PubChem CID 65248073) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2,2-dimethyl-4-(3-morpholin-4-ylpyrrolidin-1-yl)butanoic acid.
| Compound Name | 2,2-dimethyl-4-(3-morpholin-4-ylpyrrolidin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 65248073 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 2,2-dimethyl-4-(3-morpholin-4-ylpyrrolidin-1-yl)butanoic acid |
| SMILES | CC(C)(CCN1CCC(N2CCOCC2)C1)C(=O)O |
| InChI | InChI=1S/C14H26N2O3/c1-14(2,13(17)18)4-6-15-5-3-12(11-15)16-7-9-19-10-8-16/h12H,3-11H2,1-2H3,(H,17,18) |
| InChIKey | MPHANJSOPSCXML-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |