C13H22N2O3 — CID 55237498
(E)-3-methyl-4-(3-morpholin-4-ylpyrrolidin-1-yl)but-2-enoic acid (PubChem CID 55237498) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is (E)-3-methyl-4-(3-morpholin-4-ylpyrrolidin-1-yl)but-2-enoic acid.
| Compound Name | (E)-3-methyl-4-(3-morpholin-4-ylpyrrolidin-1-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 55237498 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | (E)-3-methyl-4-(3-morpholin-4-ylpyrrolidin-1-yl)but-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)CN1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C13H22N2O3/c1-11(8-13(16)17)9-14-3-2-12(10-14)15-4-6-18-7-5-15/h8,12H,2-7,9-10H2,1H3,(H,16,17)/b11-8+ |
| InChIKey | BLUDQKXHUPSEMR-DHZHZOJOSA-N |
| XLogP | 0.42 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|