C13H21N3O2 — CID 106710237
2,2-dimethyl-6-(4-methyl-2,3-dioxopiperazin-1-yl)hexanenitrile (PubChem CID 106710237) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2,2-dimethyl-6-(4-methyl-2,3-dioxopiperazin-1-yl)hexanenitrile.
| Compound Name | 2,2-dimethyl-6-(4-methyl-2,3-dioxopiperazin-1-yl)hexanenitrile |
|---|---|
| PubChem CID | 106710237 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 2,2-dimethyl-6-(4-methyl-2,3-dioxopiperazin-1-yl)hexanenitrile |
| SMILES | CN1CCN(CCCCC(C)(C)C#N)C(=O)C1=O |
| InChI | InChI=1S/C13H21N3O2/c1-13(2,10-14)6-4-5-7-16-9-8-15(3)11(17)12(16)18/h4-9H2,1-3H3 |
| InChIKey | MSSFMNVRDKDKOM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|