C13H22N2O — CID 106710243
2,2-dimethyl-6-(4-methyl-2-oxopyrrolidin-1-yl)hexanenitrile (PubChem CID 106710243) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 2,2-dimethyl-6-(4-methyl-2-oxopyrrolidin-1-yl)hexanenitrile.
| Compound Name | 2,2-dimethyl-6-(4-methyl-2-oxopyrrolidin-1-yl)hexanenitrile |
|---|---|
| PubChem CID | 106710243 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2,2-dimethyl-6-(4-methyl-2-oxopyrrolidin-1-yl)hexanenitrile |
| SMILES | CC1CC(=O)N(CCCCC(C)(C)C#N)C1 |
| InChI | InChI=1S/C13H22N2O/c1-11-8-12(16)15(9-11)7-5-4-6-13(2,3)10-14/h11H,4-9H2,1-3H3 |
| InChIKey | WMENRDSMXKCOFX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|