C21H43N3O — CID 146548352
1-tert-butyl-4-[2-[[1-(2,2-dimethylpropyl)piperidin-4-yl]methoxy]ethyl]piperazine (PubChem CID 146548352) has the molecular formula C21H43N3O and a molecular weight of 353.60 g/mol. Its IUPAC name is 1-tert-butyl-4-[2-[[1-(2,2-dimethylpropyl)piperidin-4-yl]methoxy]ethyl]piperazine.
| Compound Name | 1-tert-butyl-4-[2-[[1-(2,2-dimethylpropyl)piperidin-4-yl]methoxy]ethyl]piperazine |
|---|---|
| PubChem CID | 146548352 |
| Molecular Formula | C21H43N3O |
| Molecular Weight | 353.60 g/mol |
| Exact Mass | 353.34 |
| IUPAC Name | 1-tert-butyl-4-[2-[[1-(2,2-dimethylpropyl)piperidin-4-yl]methoxy]ethyl]piperazine |
| SMILES | CC(C)(C)CN1CCC(COCCN2CCN(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C21H43N3O/c1-20(2,3)18-23-9-7-19(8-10-23)17-25-16-15-22-11-13-24(14-12-22)21(4,5)6/h19H,7-18H2,1-6H3 |
| InChIKey | QOWDNRCHDPIAEC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.60 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|