C13H28N2OS — CID 146617007
1-[2-(3,3-dimethylbutoxy)ethyl]-4-methylsulfanylpiperazine (PubChem CID 146617007) has the molecular formula C13H28N2OS and a molecular weight of 260.45 g/mol. Its IUPAC name is 1-[2-(3,3-dimethylbutoxy)ethyl]-4-methylsulfanylpiperazine.
| Compound Name | 1-[2-(3,3-dimethylbutoxy)ethyl]-4-methylsulfanylpiperazine |
|---|---|
| PubChem CID | 146617007 |
| Molecular Formula | C13H28N2OS |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 1-[2-(3,3-dimethylbutoxy)ethyl]-4-methylsulfanylpiperazine |
| SMILES | CSN1CCN(CCOCCC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H28N2OS/c1-13(2,3)5-11-16-12-10-14-6-8-15(17-4)9-7-14/h5-12H2,1-4H3 |
| InChIKey | QNRRCNUMRGPPBX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|