C21H40N2O2 — CID 153439588
1-[2-(5,5-dimethylhex-2-ynoxy)ethyl]-4-[2-(2,2-dimethylpropoxy)ethyl]piperazine (PubChem CID 153439588) has the molecular formula C21H40N2O2 and a molecular weight of 352.56 g/mol. Its IUPAC name is 1-[2-(5,5-dimethylhex-2-ynoxy)ethyl]-4-[2-(2,2-dimethylpropoxy)ethyl]piperazine.
| Compound Name | 1-[2-(5,5-dimethylhex-2-ynoxy)ethyl]-4-[2-(2,2-dimethylpropoxy)ethyl]piperazine |
|---|---|
| PubChem CID | 153439588 |
| Molecular Formula | C21H40N2O2 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | 1-[2-(5,5-dimethylhex-2-ynoxy)ethyl]-4-[2-(2,2-dimethylpropoxy)ethyl]piperazine |
| SMILES | CC(C)(C)CC#CCOCCN1CCN(CCOCC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H40N2O2/c1-20(2,3)9-7-8-16-24-17-14-22-10-12-23(13-11-22)15-18-25-19-21(4,5)6/h9-19H2,1-6H3 |
| InChIKey | DCHDBQGGUMCZSR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|