C16H34O2S2 — CID 89088129
1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane (PubChem CID 89088129) has the molecular formula C16H34O2S2 and a molecular weight of 322.58 g/mol. Its IUPAC name is 1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane.
| Compound Name | 1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane |
|---|---|
| PubChem CID | 89088129 |
| Molecular Formula | C16H34O2S2 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane |
| SMILES | CC(C)(C)CCOCCSSCCOCCC(C)(C)C |
| InChI | InChI=1S/C16H34O2S2/c1-15(2,3)7-9-17-11-13-19-20-14-12-18-10-8-16(4,5)6/h7-14H2,1-6H3 |
| InChIKey | CQIRWJHSVWRKSC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|