About 1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane
1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane (PubChem CID 89088129) has the molecular formula C16H34O2S2
and a molecular weight of 322.58 g/mol. Its IUPAC name is 1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane.
Molecular Properties
| Compound Name | 1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane |
| PubChem CID | 89088129 |
| Molecular Formula | C16H34O2S2 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane |
| SMILES | CC(C)(C)CCOCCSSCCOCCC(C)(C)C |
| InChI | InChI=1S/C16H34O2S2/c1-15(2,3)7-9-17-11-13-19-20-14-12-18-10-8-16(4,5)6/h7-14H2,1-6H3 |
| InChIKey | CQIRWJHSVWRKSC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane?
The IUPAC name of 1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane (CID 89088129) is 1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane.
What is the SMILES notation for 1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane?
The canonical SMILES for 1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane is CC(C)(C)CCOCCSSCCOCCC(C)(C)C.
What is the InChIKey of 1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane?
The InChIKey is CQIRWJHSVWRKSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O2S2/c1-15(2,3)7-9-17-11-13-19-20-14-12-18-10-8-16(4,5)6/h7-14H2,1-6H3.
What are the key properties of 1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane?
1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane has a molecular weight of 322.58 g/mol, XLogP of 5.27, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[2-(3,3-dimethylbutoxy)ethyldisulfanyl]ethoxy]-3,3-dimethylbutane is sourced from PubChem (CID 89088129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).