C19H40O5 — CID 131972620
1-[2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethoxy]-3,3-dimethylbutane (PubChem CID 131972620) has the molecular formula C19H40O5 and a molecular weight of 348.52 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethoxy]-3,3-dimethylbutane.
| Compound Name | 1-[2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethoxy]-3,3-dimethylbutane |
|---|---|
| PubChem CID | 131972620 |
| Molecular Formula | C19H40O5 |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.29 |
| IUPAC Name | 1-[2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethoxy]-3,3-dimethylbutane |
| SMILES | CC(C)(C)CCOCCOCCOCCOCCOCC(C)(C)C |
| InChI | InChI=1S/C19H40O5/c1-18(2,3)7-8-20-9-10-21-11-12-22-13-14-23-15-16-24-17-19(4,5)6/h7-17H2,1-6H3 |
| InChIKey | JYKYSMZBAYXMBG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|