C17H36O5 — CID 134553502
2,2-dimethyl-1-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]propane (PubChem CID 134553502) has the molecular formula C17H36O5 and a molecular weight of 320.47 g/mol. Its IUPAC name is 2,2-dimethyl-1-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]propane.
| Compound Name | 2,2-dimethyl-1-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]propane |
|---|---|
| PubChem CID | 134553502 |
| Molecular Formula | C17H36O5 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | 2,2-dimethyl-1-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]propane |
| SMILES | CC(C)(C)COCCOCCOCCOCCOC(C)(C)C |
| InChI | InChI=1S/C17H36O5/c1-16(2,3)15-21-12-11-19-8-7-18-9-10-20-13-14-22-17(4,5)6/h7-15H2,1-6H3 |
| InChIKey | LBCGFEHCCHXFCJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|