C18H38O3 — CID 131972636
1-[4-(2,2-dimethylpropoxy)butoxy]-5-[(2-methylpropan-2-yl)oxy]pentane (PubChem CID 131972636) has the molecular formula C18H38O3 and a molecular weight of 302.50 g/mol. Its IUPAC name is 1-[4-(2,2-dimethylpropoxy)butoxy]-5-[(2-methylpropan-2-yl)oxy]pentane.
| Compound Name | 1-[4-(2,2-dimethylpropoxy)butoxy]-5-[(2-methylpropan-2-yl)oxy]pentane |
|---|---|
| PubChem CID | 131972636 |
| Molecular Formula | C18H38O3 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.28 |
| IUPAC Name | 1-[4-(2,2-dimethylpropoxy)butoxy]-5-[(2-methylpropan-2-yl)oxy]pentane |
| SMILES | CC(C)(C)COCCCCOCCCCCOC(C)(C)C |
| InChI | InChI=1S/C18H38O3/c1-17(2,3)16-20-14-11-10-13-19-12-8-7-9-15-21-18(4,5)6/h7-16H2,1-6H3 |
| InChIKey | OILCKVLKFBXZJE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|