C18H38O2 — CID 159349044
6,6-dimethyl-1-[5-[(2-methylpropan-2-yl)oxy]pentoxy]heptane (PubChem CID 159349044) has the molecular formula C18H38O2 and a molecular weight of 286.50 g/mol. Its IUPAC name is 6,6-dimethyl-1-[5-[(2-methylpropan-2-yl)oxy]pentoxy]heptane.
| Compound Name | 6,6-dimethyl-1-[5-[(2-methylpropan-2-yl)oxy]pentoxy]heptane |
|---|---|
| PubChem CID | 159349044 |
| Molecular Formula | C18H38O2 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.29 |
| IUPAC Name | 6,6-dimethyl-1-[5-[(2-methylpropan-2-yl)oxy]pentoxy]heptane |
| SMILES | CC(C)(C)CCCCCOCCCCCOC(C)(C)C |
| InChI | InChI=1S/C18H38O2/c1-17(2,3)13-9-7-10-14-19-15-11-8-12-16-20-18(4,5)6/h7-16H2,1-6H3 |
| InChIKey | BPZXMDGWBBGECW-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|