C35H76O3 — CID 162057209
1-(3,3-dimethylbutoxy)-3,3-dimethylbutane;4,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentane;1-(2,2-dimethylpropoxy)-4,4-dimethylpentane (PubChem CID 162057209) has the molecular formula C35H76O3 and a molecular weight of 544.99 g/mol. Its IUPAC name is 1-(3,3-dimethylbutoxy)-3,3-dimethylbutane;4,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentane;1-(2,2-dimethylpropoxy)-4,4-dimethylpentane.
| Compound Name | 1-(3,3-dimethylbutoxy)-3,3-dimethylbutane;4,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentane;1-(2,2-dimethylpropoxy)-4,4-dimethylpentane |
|---|---|
| PubChem CID | 162057209 |
| Molecular Formula | C35H76O3 |
| Molecular Weight | 544.99 g/mol |
| Exact Mass | 544.58 |
| IUPAC Name | 1-(3,3-dimethylbutoxy)-3,3-dimethylbutane;4,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentane;1-(2,2-dimethylpropoxy)-4,4-dimethylpentane |
| SMILES | CC(C)(C)CCCOC(C)(C)C.CC(C)(C)CCCOCC(C)(C)C.CC(C)(C)CCOCCC(C)(C)C |
| InChI | InChI=1S/2C12H26O.C11H24O/c1-11(2,3)7-9-13-10-8-12(4,5)6;1-11(2,3)8-7-9-13-10-12(4,5)6;1-10(2,3)8-7-9-12-11(4,5)6/h2*7-10H2,1-6H3;7-9H2,1-6H3 |
| InChIKey | YZIMTYWFEGFVPI-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.99 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|