C17H36O7 — CID 134553507
2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-methylpropane (PubChem CID 134553507) has the molecular formula C17H36O7 and a molecular weight of 352.47 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-methylpropane.
| Compound Name | 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-methylpropane |
|---|---|
| PubChem CID | 134553507 |
| Molecular Formula | C17H36O7 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-methylpropane |
| SMILES | COCCOCCOCCOCCOCCOCCOC(C)(C)C |
| InChI | InChI=1S/C17H36O7/c1-17(2,3)24-16-15-23-14-13-22-12-11-21-10-9-20-8-7-19-6-5-18-4/h5-16H2,1-4H3 |
| InChIKey | NYRCNVJBYRLYTD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|