C27H60O3 — CID 161233705
2,2-dimethylpentane;3,3-dimethyl-1-propoxybutane;3,3-dimethyl-1-(2-propoxyethoxy)butane (PubChem CID 161233705) has the molecular formula C27H60O3 and a molecular weight of 432.77 g/mol. Its IUPAC name is 2,2-dimethylpentane;3,3-dimethyl-1-propoxybutane;3,3-dimethyl-1-(2-propoxyethoxy)butane.
| Compound Name | 2,2-dimethylpentane;3,3-dimethyl-1-propoxybutane;3,3-dimethyl-1-(2-propoxyethoxy)butane |
|---|---|
| PubChem CID | 161233705 |
| Molecular Formula | C27H60O3 |
| Molecular Weight | 432.77 g/mol |
| Exact Mass | 432.45 |
| IUPAC Name | 2,2-dimethylpentane;3,3-dimethyl-1-propoxybutane;3,3-dimethyl-1-(2-propoxyethoxy)butane |
| SMILES | CCCC(C)(C)C.CCCOCCC(C)(C)C.CCCOCCOCCC(C)(C)C |
| InChI | InChI=1S/C11H24O2.C9H20O.C7H16/c1-5-7-12-9-10-13-8-6-11(2,3)4;1-5-7-10-8-6-9(2,3)4;1-5-6-7(2,3)4/h5-10H2,1-4H3;5-8H2,1-4H3;5-6H2,1-4H3 |
| InChIKey | UZBZNESJZNHBSX-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.77 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|