About bis(2,2-dimethylpentane);methane
bis(2,2-dimethylpentane);methane (PubChem CID 159859974) has the molecular formula C15H36
and a molecular weight of 216.45 g/mol. Its IUPAC name is bis(2,2-dimethylpentane);methane.
Molecular Properties
| Compound Name | bis(2,2-dimethylpentane);methane |
| PubChem CID | 159859974 |
| Molecular Formula | C15H36 |
| Molecular Weight | 216.45 g/mol |
| Exact Mass | 216.28 |
| IUPAC Name | bis(2,2-dimethylpentane);methane |
| SMILES | C.CCCC(C)(C)C.CCCC(C)(C)C |
| InChI | InChI=1S/2C7H16.CH4/c2*1-5-6-7(2,3)4;/h2*5-6H2,1-4H3;1H4 |
| InChIKey | NRAFOKDSUPNTNF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 216.45 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bis(2,2-dimethylpentane);methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,2-dimethylpentane);methane?
The IUPAC name of bis(2,2-dimethylpentane);methane (CID 159859974) is bis(2,2-dimethylpentane);methane.
What is the SMILES notation for bis(2,2-dimethylpentane);methane?
The canonical SMILES for bis(2,2-dimethylpentane);methane is C.CCCC(C)(C)C.CCCC(C)(C)C.
What is the InChIKey of bis(2,2-dimethylpentane);methane?
The InChIKey is NRAFOKDSUPNTNF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H16.CH4/c2*1-5-6-7(2,3)4;/h2*5-6H2,1-4H3;1H4.
What are the key properties of bis(2,2-dimethylpentane);methane?
bis(2,2-dimethylpentane);methane has a molecular weight of 216.45 g/mol, XLogP of 6.30, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,2-dimethylpentane);methane is sourced from PubChem (CID 159859974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).