C10H24N2O — CID 175210028
(2S)-2-aminopropanamide;2,2-dimethylpentane (PubChem CID 175210028) has the molecular formula C10H24N2O and a molecular weight of 188.31 g/mol. Its IUPAC name is (2S)-2-aminopropanamide;2,2-dimethylpentane.
| Compound Name | (2S)-2-aminopropanamide;2,2-dimethylpentane |
|---|---|
| PubChem CID | 175210028 |
| Molecular Formula | C10H24N2O |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | (2S)-2-aminopropanamide;2,2-dimethylpentane |
| SMILES | CCCC(C)(C)C.C[C@H](N)C(N)=O |
| InChI | InChI=1S/C7H16.C3H8N2O/c1-5-6-7(2,3)4;1-2(4)3(5)6/h5-6H2,1-4H3;2H,4H2,1H3,(H2,5,6)/t;2-/m.0/s1 |
| InChIKey | DMKPSLIEOJUIHJ-WNQIDUERSA-N |
| XLogP | 1.65 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |