About 2-aminopropanamide;ethane
2-aminopropanamide;ethane (PubChem CID 156828005) has the molecular formula C5H14N2O
and a molecular weight of 118.18 g/mol. Its IUPAC name is 2-aminopropanamide;ethane.
Molecular Properties
| Compound Name | 2-aminopropanamide;ethane |
| PubChem CID | 156828005 |
| Molecular Formula | C5H14N2O |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.11 |
| IUPAC Name | 2-aminopropanamide;ethane |
| SMILES | CC.CC(N)C(N)=O |
| InChI | InChI=1S/C3H8N2O.C2H6/c1-2(4)3(5)6;1-2/h2H,4H2,1H3,(H2,5,6);1-2H3 |
| InChIKey | RLMKUMRYEYSZCH-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-aminopropanamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopropanamide;ethane?
The IUPAC name of 2-aminopropanamide;ethane (CID 156828005) is 2-aminopropanamide;ethane.
What is the SMILES notation for 2-aminopropanamide;ethane?
The canonical SMILES for 2-aminopropanamide;ethane is CC.CC(N)C(N)=O.
What is the InChIKey of 2-aminopropanamide;ethane?
The InChIKey is RLMKUMRYEYSZCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2O.C2H6/c1-2(4)3(5)6;1-2/h2H,4H2,1H3,(H2,5,6);1-2H3.
What are the key properties of 2-aminopropanamide;ethane?
2-aminopropanamide;ethane has a molecular weight of 118.18 g/mol, XLogP of -0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopropanamide;ethane is sourced from PubChem (CID 156828005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).