C4H10N2O2 — CID 22877840
(2R,3S)-2-amino-3-hydroxybutanamide (PubChem CID 22877840) has the molecular formula C4H10N2O2 and a molecular weight of 118.14 g/mol. Its IUPAC name is (2R,3S)-2-amino-3-hydroxybutanamide.
| Compound Name | (2R,3S)-2-amino-3-hydroxybutanamide |
|---|---|
| PubChem CID | 22877840 |
| Molecular Formula | C4H10N2O2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | (2R,3S)-2-amino-3-hydroxybutanamide |
| SMILES | C[C@H](O)[C@@H](N)C(N)=O |
| InChI | InChI=1S/C4H10N2O2/c1-2(7)3(5)4(6)8/h2-3,7H,5H2,1H3,(H2,6,8)/t2-,3+/m0/s1 |
| InChIKey | PZUOEYPTQJILHP-STHAYSLISA-N |
| XLogP | -1.82 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |