C4H9ClN2O — CID 71420306
(2R,3S)-2-amino-3-chlorobutanamide (PubChem CID 71420306) has the molecular formula C4H9ClN2O and a molecular weight of 136.58 g/mol. Its IUPAC name is (2R,3S)-2-amino-3-chlorobutanamide.
| Compound Name | (2R,3S)-2-amino-3-chlorobutanamide |
|---|---|
| PubChem CID | 71420306 |
| Molecular Formula | C4H9ClN2O |
| Molecular Weight | 136.58 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | (2R,3S)-2-amino-3-chlorobutanamide |
| SMILES | C[C@H](Cl)[C@H](N)C(N)=O |
| InChI | InChI=1S/C4H9ClN2O/c1-2(5)3(6)4(7)8/h2-3H,6H2,1H3,(H2,7,8)/t2-,3-/m0/s1 |
| InChIKey | UNXFIYHOUZQUPW-HRFVKAFMSA-N |
| XLogP | -0.57 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.58 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|